C26H41NO5 — CID 146188732
[(2R,3E,5E)-6-[(2S,3S,4E,7S,10R)-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] pyrrolidine-1-carboxylate (PubChem CID 146188732) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is [(2R,3E,5E)-6-[(2S,3S,4E,7S,10R)-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] pyrrolidine-1-carboxylate.
| Compound Name | [(2R,3E,5E)-6-[(2S,3S,4E,7S,10R)-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146188732 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | [(2R,3E,5E)-6-[(2S,3S,4E,7S,10R)-10-hydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-2-yl]-2-methylhepta-3,5-dienyl] pyrrolidine-1-carboxylate |
| SMILES | C/C(=C\C=C\[C@@H](C)COC(=O)N1CCCC1)[C@H]1OC(=O)C[C@H](O)CC[C@H](C)C/C=C/[C@@H]1C |
| InChI | InChI=1S/C26H41NO5/c1-19-9-7-11-21(3)25(32-24(29)17-23(28)14-13-19)22(4)12-8-10-20(2)18-31-26(30)27-15-5-6-16-27/h7-8,10-12,19-21,23,25,28H,5-6,9,13-18H2,1-4H3/b10-8+,11-7+,22-12+/t19-,20-,21+,23-,25+/m1/s1 |
| InChIKey | HWJWOKVYBAKWIM-JIITVVKZSA-N |
| XLogP | 5.03 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|