C22H42Br2N2O5 — CID 146189294
tert-butyl N-[6-bromo-5-[1-bromo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]oxyhexyl]carbamate (PubChem CID 146189294) has the molecular formula C22H42Br2N2O5 and a molecular weight of 574.40 g/mol. Its IUPAC name is tert-butyl N-[6-bromo-5-[1-bromo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]oxyhexyl]carbamate.
| Compound Name | tert-butyl N-[6-bromo-5-[1-bromo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]oxyhexyl]carbamate |
|---|---|
| PubChem CID | 146189294 |
| Molecular Formula | C22H42Br2N2O5 |
| Molecular Weight | 574.40 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | tert-butyl N-[6-bromo-5-[1-bromo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]oxyhexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(CBr)OC(CBr)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H42Br2N2O5/c1-21(2,3)30-19(27)25-13-9-7-11-17(15-23)29-18(16-24)12-8-10-14-26-20(28)31-22(4,5)6/h17-18H,7-16H2,1-6H3,(H,25,27)(H,26,28) |
| InChIKey | HSJRENZADQVMDB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|