C12H11BrN2O3S — CID 146190066
(4-bromo-1,3-thiazol-2-yl)-[(4-methoxyphenyl)methyl]carbamic acid (PubChem CID 146190066) has the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. Its IUPAC name is (4-bromo-1,3-thiazol-2-yl)-[(4-methoxyphenyl)methyl]carbamic acid.
| Compound Name | (4-bromo-1,3-thiazol-2-yl)-[(4-methoxyphenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 146190066 |
| Molecular Formula | C12H11BrN2O3S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | (4-bromo-1,3-thiazol-2-yl)-[(4-methoxyphenyl)methyl]carbamic acid |
| SMILES | COc1ccc(CN(C(=O)O)c2nc(Br)cs2)cc1 |
| InChI | InChI=1S/C12H11BrN2O3S/c1-18-9-4-2-8(3-5-9)6-15(12(16)17)11-14-10(13)7-19-11/h2-5,7H,6H2,1H3,(H,16,17) |
| InChIKey | MFSWQERBCUTUJY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |