C14H12BrClN2O3 — CID 143610345
(2-bromo-5-chloro-3-pyridinyl)-[(4-methoxyphenyl)methyl]carbamic acid (PubChem CID 143610345) has the molecular formula C14H12BrClN2O3 and a molecular weight of 371.62 g/mol. Its IUPAC name is (2-bromo-5-chloro-3-pyridinyl)-[(4-methoxyphenyl)methyl]carbamic acid.
| Compound Name | (2-bromo-5-chloro-3-pyridinyl)-[(4-methoxyphenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 143610345 |
| Molecular Formula | C14H12BrClN2O3 |
| Molecular Weight | 371.62 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | (2-bromo-5-chloro-3-pyridinyl)-[(4-methoxyphenyl)methyl]carbamic acid |
| SMILES | COc1ccc(CN(C(=O)O)c2cc(Cl)cnc2Br)cc1 |
| InChI | InChI=1S/C14H12BrClN2O3/c1-21-11-4-2-9(3-5-11)8-18(14(19)20)12-6-10(16)7-17-13(12)15/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | IDUKSVNSTZWORS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|