C18H15BClN2O2S — CID 158001068
CID 158001068 (PubChem CID 158001068) has the molecular formula C18H15BClN2O2S and a molecular weight of 369.66 g/mol.
| Compound Name | CID 158001068 |
|---|---|
| PubChem CID | 158001068 |
| Molecular Formula | C18H15BClN2O2S |
| Molecular Weight | 369.66 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | — |
| SMILES | COc1ccc(CN(C(=O)c2cnc(Cl)s2)c2ccccc2)cc1.[B] |
| InChI | InChI=1S/C18H15ClN2O2S.B/c1-23-15-9-7-13(8-10-15)12-21(14-5-3-2-4-6-14)17(22)16-11-20-18(19)24-16;/h2-11H,12H2,1H3; |
| InChIKey | DHBLWBSAUKZGKD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|