C14H14ClN3O3S — CID 154963718
(4-chloro-2-methylsulfanylpyrimidin-5-yl)methyl-(4-methoxyphenyl)carbamic acid (PubChem CID 154963718) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is (4-chloro-2-methylsulfanylpyrimidin-5-yl)methyl-(4-methoxyphenyl)carbamic acid.
| Compound Name | (4-chloro-2-methylsulfanylpyrimidin-5-yl)methyl-(4-methoxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 154963718 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (4-chloro-2-methylsulfanylpyrimidin-5-yl)methyl-(4-methoxyphenyl)carbamic acid |
| SMILES | COc1ccc(N(Cc2cnc(SC)nc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C14H14ClN3O3S/c1-21-11-5-3-10(4-6-11)18(14(19)20)8-9-7-16-13(22-2)17-12(9)15/h3-7H,8H2,1-2H3,(H,19,20) |
| InChIKey | UVFFHDQEPCEPQL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |