C21H19F3N4O6S — CID 146191871
3-[4-(3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl)oxy-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylic acid (PubChem CID 146191871) has the molecular formula C21H19F3N4O6S and a molecular weight of 512.47 g/mol. Its IUPAC name is 3-[4-(3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl)oxy-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylic acid.
| Compound Name | 3-[4-(3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl)oxy-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 146191871 |
| Molecular Formula | C21H19F3N4O6S |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 3-[4-(3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl)oxy-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylic acid |
| SMILES | CCOC(=O)C(Oc1ccc(-c2nccs2)c2oc(N3CC4CC(C3)N4C(=O)O)nc12)C(F)(F)F |
| InChI | InChI=1S/C21H19F3N4O6S/c1-2-32-18(29)16(21(22,23)24)33-13-4-3-12(17-25-5-6-35-17)15-14(13)26-19(34-15)27-8-10-7-11(9-27)28(10)20(30)31/h3-6,10-11,16H,2,7-9H2,1H3,(H,30,31) |
| InChIKey | QDWXIBLNTWWVJJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |