C20H18F3N5O5S — CID 146191672
3-[4-[1-(2-amino-2-oxoethoxy)-2,2,2-trifluoroethyl]-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylic acid (PubChem CID 146191672) has the molecular formula C20H18F3N5O5S and a molecular weight of 497.46 g/mol. Its IUPAC name is 3-[4-[1-(2-amino-2-oxoethoxy)-2,2,2-trifluoroethyl]-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylic acid.
| Compound Name | 3-[4-[1-(2-amino-2-oxoethoxy)-2,2,2-trifluoroethyl]-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 146191672 |
| Molecular Formula | C20H18F3N5O5S |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 3-[4-[1-(2-amino-2-oxoethoxy)-2,2,2-trifluoroethyl]-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylic acid |
| SMILES | NC(=O)COC(c1ccc(-c2nccs2)c2oc(N3CC4CC(C3)N4C(=O)O)nc12)C(F)(F)F |
| InChI | InChI=1S/C20H18F3N5O5S/c21-20(22,23)16(32-8-13(24)29)11-1-2-12(17-25-3-4-34-17)15-14(11)26-18(33-15)27-6-9-5-10(7-27)28(9)19(30)31/h1-4,9-10,16H,5-8H2,(H2,24,29)(H,30,31) |
| InChIKey | AUQNHZCCBAFZOP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |