C22H23F3N4O3S — CID 142396664
2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-4-[2,2,2-trifluoro-1-[(1-methoxycyclopropyl)methoxy]ethyl]-1,3-benzoxazole (PubChem CID 142396664) has the molecular formula C22H23F3N4O3S and a molecular weight of 480.51 g/mol. Its IUPAC name is 2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-4-[2,2,2-trifluoro-1-[(1-methoxycyclopropyl)methoxy]ethyl]-1,3-benzoxazole.
| Compound Name | 2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-4-[2,2,2-trifluoro-1-[(1-methoxycyclopropyl)methoxy]ethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 142396664 |
| Molecular Formula | C22H23F3N4O3S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-4-[2,2,2-trifluoro-1-[(1-methoxycyclopropyl)methoxy]ethyl]-1,3-benzoxazole |
| SMILES | COC1(COC(c2ccc(-c3nccs3)c3oc(N4CC5CC(C4)N5)nc23)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H23F3N4O3S/c1-30-21(4-5-21)11-31-18(22(23,24)25)14-2-3-15(19-26-6-7-33-19)17-16(14)28-20(32-17)29-9-12-8-13(10-29)27-12/h2-3,6-7,12-13,18,27H,4-5,8-11H2,1H3 |
| InChIKey | PPKAYLOVSRTUCJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |