C23H27F3N4O3S — CID 142395901
3-[1-[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]-2,2,2-trifluoroethoxy]-2,3-dimethylbutan-2-ol (PubChem CID 142395901) has the molecular formula C23H27F3N4O3S and a molecular weight of 496.56 g/mol. Its IUPAC name is 3-[1-[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]-2,2,2-trifluoroethoxy]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[1-[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]-2,2,2-trifluoroethoxy]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 142395901 |
| Molecular Formula | C23H27F3N4O3S |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 3-[1-[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]-2,2,2-trifluoroethoxy]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)OC(c1ccc(-c2nccs2)c2oc(N3CC4CC(C3)N4)nc12)C(F)(F)F |
| InChI | InChI=1S/C23H27F3N4O3S/c1-21(2,31)22(3,4)33-18(23(24,25)26)14-5-6-15(19-27-7-8-34-19)17-16(14)29-20(32-17)30-10-12-9-13(11-30)28-12/h5-8,12-13,18,28,31H,9-11H2,1-4H3 |
| InChIKey | RKLYMNDDTWHRNE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |