C19H16F6N4O2S — CID 142396289
2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-4-[2,2,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzoxazole (PubChem CID 142396289) has the molecular formula C19H16F6N4O2S and a molecular weight of 478.42 g/mol. Its IUPAC name is 2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-4-[2,2,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzoxazole.
| Compound Name | 2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-4-[2,2,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 142396289 |
| Molecular Formula | C19H16F6N4O2S |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-4-[2,2,2-trifluoro-1-(2,2,2-trifluoroethoxy)ethyl]-1,3-benzoxazole |
| SMILES | FC(F)(F)COC(c1ccc(-c2nccs2)c2oc(N3CC4CC(C3)N4)nc12)C(F)(F)F |
| InChI | InChI=1S/C19H16F6N4O2S/c20-18(21,22)8-30-15(19(23,24)25)11-1-2-12(16-26-3-4-32-16)14-13(11)28-17(31-14)29-6-9-5-10(7-29)27-9/h1-4,9-10,15,27H,5-8H2 |
| InChIKey | BGICVVVNICUNJQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |