C20H19F5N4O3S — CID 142396554
1-[1-[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]-2,2,2-trifluoroethoxy]-1,1-difluoropropan-2-ol (PubChem CID 142396554) has the molecular formula C20H19F5N4O3S and a molecular weight of 490.45 g/mol. Its IUPAC name is 1-[1-[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]-2,2,2-trifluoroethoxy]-1,1-difluoropropan-2-ol.
| Compound Name | 1-[1-[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]-2,2,2-trifluoroethoxy]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 142396554 |
| Molecular Formula | C20H19F5N4O3S |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 1-[1-[2-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-4-yl]-2,2,2-trifluoroethoxy]-1,1-difluoropropan-2-ol |
| SMILES | CC(O)C(F)(F)OC(c1ccc(-c2nccs2)c2oc(N3CC4CC(C3)N4)nc12)C(F)(F)F |
| InChI | InChI=1S/C20H19F5N4O3S/c1-9(30)20(24,25)32-16(19(21,22)23)12-2-3-13(17-26-4-5-33-17)15-14(12)28-18(31-15)29-7-10-6-11(8-29)27-10/h2-5,9-11,16,27,30H,6-8H2,1H3 |
| InChIKey | DLODWWWNDQFOLV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |