C16H15N3O3S — CID 146198246
2-(1,3-benzothiazole-5-carbonyl)-2,7-diazaspiro[4.5]decane-6,8-dione (PubChem CID 146198246) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazole-5-carbonyl)-2,7-diazaspiro[4.5]decane-6,8-dione.
| Compound Name | 2-(1,3-benzothiazole-5-carbonyl)-2,7-diazaspiro[4.5]decane-6,8-dione |
|---|---|
| PubChem CID | 146198246 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-(1,3-benzothiazole-5-carbonyl)-2,7-diazaspiro[4.5]decane-6,8-dione |
| SMILES | O=C1CCC2(CCN(C(=O)c3ccc4scnc4c3)C2)C(=O)N1 |
| InChI | InChI=1S/C16H15N3O3S/c20-13-3-4-16(15(22)18-13)5-6-19(8-16)14(21)10-1-2-12-11(7-10)17-9-23-12/h1-2,7,9H,3-6,8H2,(H,18,20,22) |
| InChIKey | CPYVPIQYEVTFQP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|