About 1-iodotriazol-4-amine
1-iodotriazol-4-amine (PubChem CID 146200393) has the molecular formula C2H3IN4
and a molecular weight of 209.98 g/mol. Its IUPAC name is 1-iodotriazol-4-amine.
Molecular Properties
| Compound Name | 1-iodotriazol-4-amine |
| PubChem CID | 146200393 |
| Molecular Formula | C2H3IN4 |
| Molecular Weight | 209.98 g/mol |
| Exact Mass | 209.94 |
| IUPAC Name | 1-iodotriazol-4-amine |
| SMILES | Nc1cn(I)nn1 |
| InChI | InChI=1S/C2H3IN4/c3-7-1-2(4)5-6-7/h1H,4H2 |
| InChIKey | XFDXZISVCURBHT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.98 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodotriazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodotriazol-4-amine?
The IUPAC name of 1-iodotriazol-4-amine (CID 146200393) is 1-iodotriazol-4-amine.
What is the SMILES notation for 1-iodotriazol-4-amine?
The canonical SMILES for 1-iodotriazol-4-amine is Nc1cn(I)nn1.
What is the InChIKey of 1-iodotriazol-4-amine?
The InChIKey is XFDXZISVCURBHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3IN4/c3-7-1-2(4)5-6-7/h1H,4H2.
What are the key properties of 1-iodotriazol-4-amine?
1-iodotriazol-4-amine has a molecular weight of 209.98 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodotriazol-4-amine is sourced from PubChem (CID 146200393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).