C9H16N4 — CID 165481462
1-(3,4-dimethylpent-3-enyl)triazol-4-amine (PubChem CID 165481462) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(3,4-dimethylpent-3-enyl)triazol-4-amine.
| Compound Name | 1-(3,4-dimethylpent-3-enyl)triazol-4-amine |
|---|---|
| PubChem CID | 165481462 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-(3,4-dimethylpent-3-enyl)triazol-4-amine |
| SMILES | CC(C)=C(C)CCn1cc(N)nn1 |
| InChI | InChI=1S/C9H16N4/c1-7(2)8(3)4-5-13-6-9(10)11-12-13/h6H,4-5,10H2,1-3H3 |
| InChIKey | DAXNFOCUCZGGOW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|