C26H32N6O2 — CID 146202010
(E)-1-N-cyclopentyl-1-N'-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indol-1-yl]but-1-ene-1,1,3-triamine (PubChem CID 146202010) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (E)-1-N-cyclopentyl-1-N'-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indol-1-yl]but-1-ene-1,1,3-triamine.
| Compound Name | (E)-1-N-cyclopentyl-1-N'-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indol-1-yl]but-1-ene-1,1,3-triamine |
|---|---|
| PubChem CID | 146202010 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (E)-1-N-cyclopentyl-1-N'-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indol-1-yl]but-1-ene-1,1,3-triamine |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1ccnc(N/C(=C/C(C)N)NC3CCCC3)c12 |
| InChI | InChI=1S/C26H32N6O2/c1-14(27)11-23(29-17-7-5-6-8-17)31-26-25-18-13-22(33-4)19(24-15(2)32-34-16(24)3)12-21(18)30-20(25)9-10-28-26/h9-14,17,29-30H,5-8,27H2,1-4H3,(H,28,31)/b23-11+ |
| InChIKey | GSKAPAPZWMPIOF-FOKLQQMPSA-N |
| XLogP | 5.13 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |