C22H28F2N6O — CID 146202613
2-cyclopropyl-7-[[1-[[(1R)-3,3-difluorocyclopentyl]methyl]pyrazol-4-yl]methylamino]-1,5-dimethyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one (PubChem CID 146202613) has the molecular formula C22H28F2N6O and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-cyclopropyl-7-[[1-[[(1R)-3,3-difluorocyclopentyl]methyl]pyrazol-4-yl]methylamino]-1,5-dimethyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one.
| Compound Name | 2-cyclopropyl-7-[[1-[[(1R)-3,3-difluorocyclopentyl]methyl]pyrazol-4-yl]methylamino]-1,5-dimethyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 146202613 |
| Molecular Formula | C22H28F2N6O |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-cyclopropyl-7-[[1-[[(1R)-3,3-difluorocyclopentyl]methyl]pyrazol-4-yl]methylamino]-1,5-dimethyl-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
| SMILES | Cc1nc(NCc2cnn(C[C@@H]3CCC(F)(F)C3)c2)cc2c1NC(=O)C(C1CC1)N2C |
| InChI | InChI=1S/C22H28F2N6O/c1-13-19-17(29(2)20(16-3-4-16)21(31)28-19)7-18(27-13)25-9-15-10-26-30(12-15)11-14-5-6-22(23,24)8-14/h7,10,12,14,16,20H,3-6,8-9,11H2,1-2H3,(H,25,27)(H,28,31)/t14-,20?/m1/s1 |
| InChIKey | OBISLMUZKYRELM-QMRFKDRMSA-N |
| XLogP | 3.80 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |