C24H28F3N5O2 — CID 146203655
1,5-dimethyl-2-propan-2-yl-7-[[1-(3,4,5-trifluorobenzoyl)piperidin-4-yl]amino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one (PubChem CID 146203655) has the molecular formula C24H28F3N5O2 and a molecular weight of 475.52 g/mol. Its IUPAC name is 1,5-dimethyl-2-propan-2-yl-7-[[1-(3,4,5-trifluorobenzoyl)piperidin-4-yl]amino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one.
| Compound Name | 1,5-dimethyl-2-propan-2-yl-7-[[1-(3,4,5-trifluorobenzoyl)piperidin-4-yl]amino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 146203655 |
| Molecular Formula | C24H28F3N5O2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 1,5-dimethyl-2-propan-2-yl-7-[[1-(3,4,5-trifluorobenzoyl)piperidin-4-yl]amino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
| SMILES | Cc1nc(NC2CCN(C(=O)c3cc(F)c(F)c(F)c3)CC2)cc2c1NC(=O)C(C(C)C)N2C |
| InChI | InChI=1S/C24H28F3N5O2/c1-12(2)22-23(33)30-21-13(3)28-19(11-18(21)31(22)4)29-15-5-7-32(8-6-15)24(34)14-9-16(25)20(27)17(26)10-14/h9-12,15,22H,5-8H2,1-4H3,(H,28,29)(H,30,33) |
| InChIKey | VQTDBRNBESMGHQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|