C21H23F3N6O2 — CID 146203360
N-[4-[[(7S)-4,7-dimethyl-6-oxo-7,8-dihydro-5H-pteridin-2-yl]amino]cyclohexyl]-3,4,5-trifluorobenzamide (PubChem CID 146203360) has the molecular formula C21H23F3N6O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is N-[4-[[(7S)-4,7-dimethyl-6-oxo-7,8-dihydro-5H-pteridin-2-yl]amino]cyclohexyl]-3,4,5-trifluorobenzamide.
| Compound Name | N-[4-[[(7S)-4,7-dimethyl-6-oxo-7,8-dihydro-5H-pteridin-2-yl]amino]cyclohexyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 146203360 |
| Molecular Formula | C21H23F3N6O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[4-[[(7S)-4,7-dimethyl-6-oxo-7,8-dihydro-5H-pteridin-2-yl]amino]cyclohexyl]-3,4,5-trifluorobenzamide |
| SMILES | Cc1nc(NC2CCC(NC(=O)c3cc(F)c(F)c(F)c3)CC2)nc2c1NC(=O)[C@H](C)N2 |
| InChI | InChI=1S/C21H23F3N6O2/c1-9-17-18(25-10(2)19(31)29-17)30-21(26-9)28-13-5-3-12(4-6-13)27-20(32)11-7-14(22)16(24)15(23)8-11/h7-8,10,12-13H,3-6H2,1-2H3,(H,27,32)(H,29,31)(H2,25,26,28,30)/t10-,12?,13?/m0/s1 |
| InChIKey | LGXRMMVERCSPMS-PKSQDBQZSA-N |
| XLogP | 3.11 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|