C22H25ClF3N3O — CID 69241358
3,4,5-trifluoro-N-[4-(5,6,7,8-tetrahydroquinolin-2-ylamino)cyclohexyl]benzamide;hydrochloride (PubChem CID 69241358) has the molecular formula C22H25ClF3N3O and a molecular weight of 439.91 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[4-(5,6,7,8-tetrahydroquinolin-2-ylamino)cyclohexyl]benzamide;hydrochloride.
| Compound Name | 3,4,5-trifluoro-N-[4-(5,6,7,8-tetrahydroquinolin-2-ylamino)cyclohexyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 69241358 |
| Molecular Formula | C22H25ClF3N3O |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 3,4,5-trifluoro-N-[4-(5,6,7,8-tetrahydroquinolin-2-ylamino)cyclohexyl]benzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCC(Nc2ccc3c(n2)CCCC3)CC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C22H24F3N3O.ClH/c23-17-11-14(12-18(24)21(17)25)22(29)27-16-8-6-15(7-9-16)26-20-10-5-13-3-1-2-4-19(13)28-20;/h5,10-12,15-16H,1-4,6-9H2,(H,26,28)(H,27,29);1H |
| InChIKey | MENCNADBECHJRB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|