C22H24F3N5O2 — CID 146202728
1,5-dimethyl-2-propan-2-yl-7-[[1-(3,4,5-trifluorobenzoyl)azetidin-3-yl]amino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one (PubChem CID 146202728) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 1,5-dimethyl-2-propan-2-yl-7-[[1-(3,4,5-trifluorobenzoyl)azetidin-3-yl]amino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one.
| Compound Name | 1,5-dimethyl-2-propan-2-yl-7-[[1-(3,4,5-trifluorobenzoyl)azetidin-3-yl]amino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 146202728 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 1,5-dimethyl-2-propan-2-yl-7-[[1-(3,4,5-trifluorobenzoyl)azetidin-3-yl]amino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one |
| SMILES | Cc1nc(NC2CN(C(=O)c3cc(F)c(F)c(F)c3)C2)cc2c1NC(=O)C(C(C)C)N2C |
| InChI | InChI=1S/C22H24F3N5O2/c1-10(2)20-21(31)28-19-11(3)26-17(7-16(19)29(20)4)27-13-8-30(9-13)22(32)12-5-14(23)18(25)15(24)6-12/h5-7,10,13,20H,8-9H2,1-4H3,(H,26,27)(H,28,31) |
| InChIKey | QDYPGNFXTCPUNX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|