C8H17N3O — CID 146205581
N,N-dimethyl-2-[(methylideneamino)-propan-2-ylamino]acetamide (PubChem CID 146205581) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is N,N-dimethyl-2-[(methylideneamino)-propan-2-ylamino]acetamide.
| Compound Name | N,N-dimethyl-2-[(methylideneamino)-propan-2-ylamino]acetamide |
|---|---|
| PubChem CID | 146205581 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N,N-dimethyl-2-[(methylideneamino)-propan-2-ylamino]acetamide |
| SMILES | C=NN(CC(=O)N(C)C)C(C)C |
| InChI | InChI=1S/C8H17N3O/c1-7(2)11(9-3)6-8(12)10(4)5/h7H,3,6H2,1-2,4-5H3 |
| InChIKey | QZMZVJUZHQAKAI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|