C11H22N4O3 — CID 172988820
[(3S)-3-[[2-(dimethylamino)-2-oxoethyl]-[(Z)-ethylideneamino]amino]butan-2-yl]carbamic acid (PubChem CID 172988820) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is [(3S)-3-[[2-(dimethylamino)-2-oxoethyl]-[(Z)-ethylideneamino]amino]butan-2-yl]carbamic acid.
| Compound Name | [(3S)-3-[[2-(dimethylamino)-2-oxoethyl]-[(Z)-ethylideneamino]amino]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 172988820 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | [(3S)-3-[[2-(dimethylamino)-2-oxoethyl]-[(Z)-ethylideneamino]amino]butan-2-yl]carbamic acid |
| SMILES | C/C=N\N(CC(=O)N(C)C)[C@@H](C)C(C)NC(=O)O |
| InChI | InChI=1S/C11H22N4O3/c1-6-12-15(7-10(16)14(4)5)9(3)8(2)13-11(17)18/h6,8-9,13H,7H2,1-5H3,(H,17,18)/b12-6-/t8?,9-/m0/s1 |
| InChIKey | LTRMCEUONCTBNB-FWDQZQJBSA-N |
| XLogP | 0.43 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|