About 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline
1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline (PubChem CID 146207875) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline.
Molecular Properties
| Compound Name | 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline |
| PubChem CID | 146207875 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline |
| SMILES | C=C1CCc2cc(-c3ccc(C(C)C)cc3)ccc2N1C |
| InChI | InChI=1S/C20H23N/c1-14(2)16-7-9-17(10-8-16)18-11-12-20-19(13-18)6-5-15(3)21(20)4/h7-14H,3,5-6H2,1-2,4H3 |
| InChIKey | MDHSIKRYWVKRKM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline?
The IUPAC name of 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline (CID 146207875) is 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline.
What is the SMILES notation for 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline?
The canonical SMILES for 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline is C=C1CCc2cc(-c3ccc(C(C)C)cc3)ccc2N1C.
What is the InChIKey of 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline?
The InChIKey is MDHSIKRYWVKRKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N/c1-14(2)16-7-9-17(10-8-16)18-11-12-20-19(13-18)6-5-15(3)21(20)4/h7-14H,3,5-6H2,1-2,4H3.
What are the key properties of 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline?
1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline has a molecular weight of 277.41 g/mol, XLogP of 5.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-methylidene-6-(4-propan-2-ylphenyl)-3,4-dihydroquinoline is sourced from PubChem (CID 146207875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).