About ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole
ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole (PubChem CID 142314635) has the molecular formula C18H24N2
and a molecular weight of 268.40 g/mol. Its IUPAC name is ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole.
Molecular Properties
| Compound Name | ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole |
| PubChem CID | 142314635 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole |
| SMILES | CC.CC(C)c1ccc(-c2ccc3c(c2)CNN3)cc1 |
| InChI | InChI=1S/C16H18N2.C2H6/c1-11(2)12-3-5-13(6-4-12)14-7-8-16-15(9-14)10-17-18-16;1-2/h3-9,11,17-18H,10H2,1-2H3;1-2H3 |
| InChIKey | UOTHLNRXLHACKC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole?
The IUPAC name of ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole (CID 142314635) is ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole.
What is the SMILES notation for ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole?
The canonical SMILES for ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole is CC.CC(C)c1ccc(-c2ccc3c(c2)CNN3)cc1.
What is the InChIKey of ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole?
The InChIKey is UOTHLNRXLHACKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2.C2H6/c1-11(2)12-3-5-13(6-4-12)14-7-8-16-15(9-14)10-17-18-16;1-2/h3-9,11,17-18H,10H2,1-2H3;1-2H3.
What are the key properties of ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole?
ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole has a molecular weight of 268.40 g/mol, XLogP of 4.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indazole is sourced from PubChem (CID 142314635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).