About azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride
azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride (PubChem CID 175178296) has the molecular formula C16H21Cl2N3
and a molecular weight of 326.27 g/mol. Its IUPAC name is azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride.
Molecular Properties
| Compound Name | azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride |
| PubChem CID | 175178296 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride |
| SMILES | CC(C)c1ccc(-c2ccc3[nH]ncc3c2)cc1.Cl.Cl.N |
| InChI | InChI=1S/C16H16N2.2ClH.H3N/c1-11(2)12-3-5-13(6-4-12)14-7-8-16-15(9-14)10-17-18-16;;;/h3-11H,1-2H3,(H,17,18);2*1H;1H3 |
| InChIKey | CZQKAOXCOSLXEC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride?
The IUPAC name of azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride (CID 175178296) is azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride.
What is the SMILES notation for azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride?
The canonical SMILES for azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride is CC(C)c1ccc(-c2ccc3[nH]ncc3c2)cc1.Cl.Cl.N.
What is the InChIKey of azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride?
The InChIKey is CZQKAOXCOSLXEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2.2ClH.H3N/c1-11(2)12-3-5-13(6-4-12)14-7-8-16-15(9-14)10-17-18-16;;;/h3-11H,1-2H3,(H,17,18);2*1H;1H3.
What are the key properties of azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride?
azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride has a molecular weight of 326.27 g/mol, XLogP of 5.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-(4-propan-2-ylphenyl)-1H-indazole;dihydrochloride is sourced from PubChem (CID 175178296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).