C17H21F3N4O2 — CID 146209739
ethyl 1-cyclopentyl-5-[(1E,3Z)-1-(methylideneamino)-2-(trifluoromethyl)penta-1,3-dienyl]-1,2,4-triazole-3-carboxylate (PubChem CID 146209739) has the molecular formula C17H21F3N4O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is ethyl 1-cyclopentyl-5-[(1E,3Z)-1-(methylideneamino)-2-(trifluoromethyl)penta-1,3-dienyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 1-cyclopentyl-5-[(1E,3Z)-1-(methylideneamino)-2-(trifluoromethyl)penta-1,3-dienyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 146209739 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | ethyl 1-cyclopentyl-5-[(1E,3Z)-1-(methylideneamino)-2-(trifluoromethyl)penta-1,3-dienyl]-1,2,4-triazole-3-carboxylate |
| SMILES | C=N/C(=C(\C=C/C)C(F)(F)F)c1nc(C(=O)OCC)nn1C1CCCC1 |
| InChI | InChI=1S/C17H21F3N4O2/c1-4-8-12(17(18,19)20)13(21-3)15-22-14(16(25)26-5-2)23-24(15)11-9-6-7-10-11/h4,8,11H,3,5-7,9-10H2,1-2H3/b8-4-,13-12+ |
| InChIKey | QBVMBPGSUPFGPS-ZQGSCZMJSA-N |
| XLogP | 4.12 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|