C30H42N6O9 — CID 146209743
2-[[2-[[3,3-dimethyl-1-[(3R)-3-[[2-(4-methylpent-1-en-3-ylamino)-2-oxoethyl]carbamoyl]piperidin-1-yl]-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamoyl]-5-nitrobenzoic acid (PubChem CID 146209743) has the molecular formula C30H42N6O9 and a molecular weight of 630.70 g/mol. Its IUPAC name is 2-[[2-[[3,3-dimethyl-1-[(3R)-3-[[2-(4-methylpent-1-en-3-ylamino)-2-oxoethyl]carbamoyl]piperidin-1-yl]-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamoyl]-5-nitrobenzoic acid.
| Compound Name | 2-[[2-[[3,3-dimethyl-1-[(3R)-3-[[2-(4-methylpent-1-en-3-ylamino)-2-oxoethyl]carbamoyl]piperidin-1-yl]-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamoyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 146209743 |
| Molecular Formula | C30H42N6O9 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 2-[[2-[[3,3-dimethyl-1-[(3R)-3-[[2-(4-methylpent-1-en-3-ylamino)-2-oxoethyl]carbamoyl]piperidin-1-yl]-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamoyl]-5-nitrobenzoic acid |
| SMILES | C=CC(NC(=O)CNC(=O)[C@@H]1CCCN(C(=O)C(NC(=O)CNC(=O)c2ccc([N+](=O)[O-])cc2C(=O)O)C(C)(C)C)C1)C(C)C |
| InChI | InChI=1S/C30H42N6O9/c1-7-22(17(2)3)33-23(37)14-31-26(39)18-9-8-12-35(16-18)28(41)25(30(4,5)6)34-24(38)15-32-27(40)20-11-10-19(36(44)45)13-21(20)29(42)43/h7,10-11,13,17-18,22,25H,1,8-9,12,14-16H2,2-6H3,(H,31,39)(H,32,40)(H,33,37)(H,34,38)(H,42,43)/t18-,22?,25?/m1/s1 |
| InChIKey | PIKLMGXVAJXEOI-KJIJUEMSSA-N |
| XLogP | 1.24 |
| TPSA | 217.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|