C15H18F3N3O3 — CID 146217823
[(3R)-5-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 146217823) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is [(3R)-5-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3R)-5-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 146217823 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [(3R)-5-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CNC(C(=O)NCCc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H18F3N3O3/c16-15(17,18)10-3-1-9(2-4-10)5-6-19-13(22)12-7-11(8-20-12)21-14(23)24/h1-4,11-12,20-21H,5-8H2,(H,19,22)(H,23,24)/t11-,12?/m1/s1 |
| InChIKey | ZJEOXBDTNHXVQU-JHJMLUEUSA-N |
| XLogP | 1.36 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |