C13H18F3N3O5 — CID 146218267
methyl 3-[3-methoxy-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoate (PubChem CID 146218267) has the molecular formula C13H18F3N3O5 and a molecular weight of 353.30 g/mol. Its IUPAC name is methyl 3-[3-methoxy-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoate.
| Compound Name | methyl 3-[3-methoxy-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoate |
|---|---|
| PubChem CID | 146218267 |
| Molecular Formula | C13H18F3N3O5 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | methyl 3-[3-methoxy-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]propanoate |
| SMILES | COCC(COCCC(=O)OC)Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O5/c1-22-6-8(7-24-4-3-10(20)23-2)18-9-5-17-19-12(21)11(9)13(14,15)16/h5,8H,3-4,6-7H2,1-2H3,(H2,18,19,21) |
| InChIKey | ZNZVBMDEECYRRD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|