C14H20F3N3O4 — CID 146218410
methyl 3-[3-methyl-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]butoxy]propanoate (PubChem CID 146218410) has the molecular formula C14H20F3N3O4 and a molecular weight of 351.33 g/mol. Its IUPAC name is methyl 3-[3-methyl-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]butoxy]propanoate.
| Compound Name | methyl 3-[3-methyl-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]butoxy]propanoate |
|---|---|
| PubChem CID | 146218410 |
| Molecular Formula | C14H20F3N3O4 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | methyl 3-[3-methyl-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]butoxy]propanoate |
| SMILES | COC(=O)CCOCC(Nc1cn[nH]c(=O)c1C(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H20F3N3O4/c1-8(2)10(7-24-5-4-11(21)23-3)19-9-6-18-20-13(22)12(9)14(15,16)17/h6,8,10H,4-5,7H2,1-3H3,(H2,19,20,22) |
| InChIKey | UJJMJLWWUKOKQE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|