C17H21F3N6O2 — CID 146219381
2-[5-(azidomethyl)oxolan-2-yl]-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 146219381) has the molecular formula C17H21F3N6O2 and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-[5-(azidomethyl)oxolan-2-yl]-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[5-(azidomethyl)oxolan-2-yl]-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 146219381 |
| Molecular Formula | C17H21F3N6O2 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[5-(azidomethyl)oxolan-2-yl]-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | [N-]=[N+]=NCC1CCC(CC(=O)N2CCN(c3ccc(C(F)(F)F)cn3)CC2)O1 |
| InChI | InChI=1S/C17H21F3N6O2/c18-17(19,20)12-1-4-15(22-10-12)25-5-7-26(8-6-25)16(27)9-13-2-3-14(28-13)11-23-24-21/h1,4,10,13-14H,2-3,5-9,11H2 |
| InChIKey | POWONESGORSVNU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|