C35H43N3O4S — CID 146221025
3-cyclononyl-5-hydroxy-N-[[4-(3-pyrrolidin-1-ylphenyl)sulfonylphenyl]methyl]-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 146221025) has the molecular formula C35H43N3O4S and a molecular weight of 601.81 g/mol. Its IUPAC name is 3-cyclononyl-5-hydroxy-N-[[4-(3-pyrrolidin-1-ylphenyl)sulfonylphenyl]methyl]-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | 3-cyclononyl-5-hydroxy-N-[[4-(3-pyrrolidin-1-ylphenyl)sulfonylphenyl]methyl]-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146221025 |
| Molecular Formula | C35H43N3O4S |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | 3-cyclononyl-5-hydroxy-N-[[4-(3-pyrrolidin-1-ylphenyl)sulfonylphenyl]methyl]-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)c2cccc(N3CCCC3)c2)cc1)C1Nc2ccc(O)cc2C1C1CCCCCCCC1 |
| InChI | InChI=1S/C35H43N3O4S/c39-28-16-19-32-31(23-28)33(26-10-5-3-1-2-4-6-11-26)34(37-32)35(40)36-24-25-14-17-29(18-15-25)43(41,42)30-13-9-12-27(22-30)38-20-7-8-21-38/h9,12-19,22-23,26,33-34,37,39H,1-8,10-11,20-21,24H2,(H,36,40) |
| InChIKey | SPMVLAJMPMBKBG-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|