C12H17N3O2S — CID 146223163
ethyl 2-amino-5-(4,4-dimethyldiazet-1-yl)-4-methylthiophene-3-carboxylate (PubChem CID 146223163) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is ethyl 2-amino-5-(4,4-dimethyldiazet-1-yl)-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-5-(4,4-dimethyldiazet-1-yl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 146223163 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | ethyl 2-amino-5-(4,4-dimethyldiazet-1-yl)-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(N2N=CC2(C)C)c1C |
| InChI | InChI=1S/C12H17N3O2S/c1-5-17-11(16)8-7(2)10(18-9(8)13)15-12(3,4)6-14-15/h6H,5,13H2,1-4H3 |
| InChIKey | ZKQOZLQLTCBOJQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|