C12H22N4O2 — CID 146233506
2-[[6-(tert-butylamino)pyrimidin-4-yl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 146233506) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[[6-(tert-butylamino)pyrimidin-4-yl]-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[6-(tert-butylamino)pyrimidin-4-yl]-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 146233506 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-[[6-(tert-butylamino)pyrimidin-4-yl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | CC(C)(C)Nc1cc(N(CCO)CCO)ncn1 |
| InChI | InChI=1S/C12H22N4O2/c1-12(2,3)15-10-8-11(14-9-13-10)16(4-6-17)5-7-18/h8-9,17-18H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | ZKHDQUGEVIOWMJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |