C15H28N4 — CID 107871767
6-N-methyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine (PubChem CID 107871767) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is 6-N-methyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107871767 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 6-N-methyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine |
| SMILES | CNc1cc(N(CCC(C)C)CCC(C)C)ncn1 |
| InChI | InChI=1S/C15H28N4/c1-12(2)6-8-19(9-7-13(3)4)15-10-14(16-5)17-11-18-15/h10-13H,6-9H2,1-5H3,(H,16,17,18) |
| InChIKey | GTPSNVWJLFXRMZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |