C25H34N6O4 — CID 146234136
tert-butyl 4-[4-[1-[(1-ethyl-2-oxo-4H-pyrimido[4,5-d][1,3]oxazin-7-yl)amino]ethyl]phenyl]piperazine-1-carboxylate (PubChem CID 146234136) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is tert-butyl 4-[4-[1-[(1-ethyl-2-oxo-4H-pyrimido[4,5-d][1,3]oxazin-7-yl)amino]ethyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[1-[(1-ethyl-2-oxo-4H-pyrimido[4,5-d][1,3]oxazin-7-yl)amino]ethyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146234136 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | tert-butyl 4-[4-[1-[(1-ethyl-2-oxo-4H-pyrimido[4,5-d][1,3]oxazin-7-yl)amino]ethyl]phenyl]piperazine-1-carboxylate |
| SMILES | CCN1C(=O)OCc2cnc(NC(C)c3ccc(N4CCN(C(=O)OC(C)(C)C)CC4)cc3)nc21 |
| InChI | InChI=1S/C25H34N6O4/c1-6-31-21-19(16-34-24(31)33)15-26-22(28-21)27-17(2)18-7-9-20(10-8-18)29-11-13-30(14-12-29)23(32)35-25(3,4)5/h7-10,15,17H,6,11-14,16H2,1-5H3,(H,26,27,28) |
| InChIKey | AISQYYXGXLCVCW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|