C28H38N6O3 — CID 166926238
2-[[4-[1-[4-[(1S)-1-[(1-ethyl-2-oxo-4H-pyrimido[4,5-d][1,3]oxazin-7-yl)amino]ethyl]phenyl]-2-methylpropyl]piperazin-1-yl]methyl]prop-2-enal (PubChem CID 166926238) has the molecular formula C28H38N6O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[[4-[1-[4-[(1S)-1-[(1-ethyl-2-oxo-4H-pyrimido[4,5-d][1,3]oxazin-7-yl)amino]ethyl]phenyl]-2-methylpropyl]piperazin-1-yl]methyl]prop-2-enal.
| Compound Name | 2-[[4-[1-[4-[(1S)-1-[(1-ethyl-2-oxo-4H-pyrimido[4,5-d][1,3]oxazin-7-yl)amino]ethyl]phenyl]-2-methylpropyl]piperazin-1-yl]methyl]prop-2-enal |
|---|---|
| PubChem CID | 166926238 |
| Molecular Formula | C28H38N6O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 2-[[4-[1-[4-[(1S)-1-[(1-ethyl-2-oxo-4H-pyrimido[4,5-d][1,3]oxazin-7-yl)amino]ethyl]phenyl]-2-methylpropyl]piperazin-1-yl]methyl]prop-2-enal |
| SMILES | C=C(C=O)CN1CCN(C(c2ccc([C@H](C)Nc3ncc4c(n3)N(CC)C(=O)OC4)cc2)C(C)C)CC1 |
| InChI | InChI=1S/C28H38N6O3/c1-6-34-26-24(18-37-28(34)36)15-29-27(31-26)30-21(5)22-7-9-23(10-8-22)25(19(2)3)33-13-11-32(12-14-33)16-20(4)17-35/h7-10,15,17,19,21,25H,4,6,11-14,16,18H2,1-3,5H3,(H,29,30,31)/t21-,25?/m0/s1 |
| InChIKey | WMNAFMSYRDVOHK-BWDMCYIDSA-N |
| XLogP | 4.20 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|