About (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol
(6R)-6-ethyl-2,2-dimethylpiperidin-4-ol (PubChem CID 146238293) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol |
| PubChem CID | 146238293 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol |
| SMILES | CC[C@@H]1CC(O)CC(C)(C)N1 |
| InChI | InChI=1S/C9H19NO/c1-4-7-5-8(11)6-9(2,3)10-7/h7-8,10-11H,4-6H2,1-3H3/t7-,8?/m1/s1 |
| InChIKey | ZXEUPYBNJZBSDU-GVHYBUMESA-N |
| XLogP | 1.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol?
The IUPAC name of (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol (CID 146238293) is (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol.
What is the SMILES notation for (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol?
The canonical SMILES for (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol is CC[C@@H]1CC(O)CC(C)(C)N1.
What is the InChIKey of (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol?
The InChIKey is ZXEUPYBNJZBSDU-GVHYBUMESA-N. The full InChI is InChI=1S/C9H19NO/c1-4-7-5-8(11)6-9(2,3)10-7/h7-8,10-11H,4-6H2,1-3H3/t7-,8?/m1/s1.
What are the key properties of (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol?
(6R)-6-ethyl-2,2-dimethylpiperidin-4-ol has a molecular weight of 157.26 g/mol, XLogP of 1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-ethyl-2,2-dimethylpiperidin-4-ol is sourced from PubChem (CID 146238293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).