C29H43N5O3 — CID 146238983
1-[3-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-oxoquinoxalin-1-yl]butyl-ethylamino]cyclooctane-1-carboxylic acid (PubChem CID 146238983) has the molecular formula C29H43N5O3 and a molecular weight of 509.70 g/mol. Its IUPAC name is 1-[3-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-oxoquinoxalin-1-yl]butyl-ethylamino]cyclooctane-1-carboxylic acid.
| Compound Name | 1-[3-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-oxoquinoxalin-1-yl]butyl-ethylamino]cyclooctane-1-carboxylic acid |
|---|---|
| PubChem CID | 146238983 |
| Molecular Formula | C29H43N5O3 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | 1-[3-[3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-oxoquinoxalin-1-yl]butyl-ethylamino]cyclooctane-1-carboxylic acid |
| SMILES | CCN(CCC(C)n1c(=O)c(N2CC3CNCC3C2)nc2ccccc21)C1(C(=O)O)CCCCCCC1 |
| InChI | InChI=1S/C29H43N5O3/c1-3-33(29(28(36)37)14-9-5-4-6-10-15-29)16-13-21(2)34-25-12-8-7-11-24(25)31-26(27(34)35)32-19-22-17-30-18-23(22)20-32/h7-8,11-12,21-23,30H,3-6,9-10,13-20H2,1-2H3,(H,36,37) |
| InChIKey | MKVBBTRHJGOYBH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |