C25H20N6 — CID 146242878
3-[8-(3-aminophenyl)-2-imino-3-methylimidazo[4,5-c]quinolin-1-yl]-4-methylbenzonitrile (PubChem CID 146242878) has the molecular formula C25H20N6 and a molecular weight of 404.48 g/mol. Its IUPAC name is 3-[8-(3-aminophenyl)-2-imino-3-methylimidazo[4,5-c]quinolin-1-yl]-4-methylbenzonitrile.
| Compound Name | 3-[8-(3-aminophenyl)-2-imino-3-methylimidazo[4,5-c]quinolin-1-yl]-4-methylbenzonitrile |
|---|---|
| PubChem CID | 146242878 |
| Molecular Formula | C25H20N6 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 3-[8-(3-aminophenyl)-2-imino-3-methylimidazo[4,5-c]quinolin-1-yl]-4-methylbenzonitrile |
| SMILES | [H]/N=c1\n(C)c2cnc3ccc(-c4cccc(N)c4)cc3c2n1-c1cc(C#N)ccc1C |
| InChI | InChI=1S/C25H20N6/c1-15-6-7-16(13-26)10-22(15)31-24-20-12-18(17-4-3-5-19(27)11-17)8-9-21(20)29-14-23(24)30(2)25(31)28/h3-12,14,28H,27H2,1-2H3/b28-25+ |
| InChIKey | PRCUCNJLWGOSHZ-AZPGRJICSA-N |
| XLogP | 4.43 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|