C29H24ClN7O — CID 146248982
5-[8-(4-chlorophenyl)-2-imino-3-methylimidazo[4,5-c]quinolin-1-yl]-4-methyl-2-(3-oxopiperazin-1-yl)benzonitrile (PubChem CID 146248982) has the molecular formula C29H24ClN7O and a molecular weight of 522.01 g/mol. Its IUPAC name is 5-[8-(4-chlorophenyl)-2-imino-3-methylimidazo[4,5-c]quinolin-1-yl]-4-methyl-2-(3-oxopiperazin-1-yl)benzonitrile.
| Compound Name | 5-[8-(4-chlorophenyl)-2-imino-3-methylimidazo[4,5-c]quinolin-1-yl]-4-methyl-2-(3-oxopiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 146248982 |
| Molecular Formula | C29H24ClN7O |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 5-[8-(4-chlorophenyl)-2-imino-3-methylimidazo[4,5-c]quinolin-1-yl]-4-methyl-2-(3-oxopiperazin-1-yl)benzonitrile |
| SMILES | [H]/N=c1\n(C)c2cnc3ccc(-c4ccc(Cl)cc4)cc3c2n1-c1cc(C#N)c(N2CCNC(=O)C2)cc1C |
| InChI | InChI=1S/C29H24ClN7O/c1-17-11-25(36-10-9-33-27(38)16-36)20(14-31)13-24(17)37-28-22-12-19(18-3-6-21(30)7-4-18)5-8-23(22)34-15-26(28)35(2)29(37)32/h3-8,11-13,15,32H,9-10,16H2,1-2H3,(H,33,38)/b32-29+ |
| InChIKey | GQKPGFFZHLOEEH-UUDCSCGESA-N |
| XLogP | 4.43 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|