C18H20FN3O4S — CID 146242907
3-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-4-[(4-fluorophenyl)methyl]-5-oxopyrazin-2-yl]propanal (PubChem CID 146242907) has the molecular formula C18H20FN3O4S and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-4-[(4-fluorophenyl)methyl]-5-oxopyrazin-2-yl]propanal.
| Compound Name | 3-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-4-[(4-fluorophenyl)methyl]-5-oxopyrazin-2-yl]propanal |
|---|---|
| PubChem CID | 146242907 |
| Molecular Formula | C18H20FN3O4S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-4-[(4-fluorophenyl)methyl]-5-oxopyrazin-2-yl]propanal |
| SMILES | O=CCCc1cn(Cc2ccc(F)cc2)c(=O)c(N2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C18H20FN3O4S/c19-15-5-3-14(4-6-15)12-22-13-16(2-1-9-23)20-17(18(22)24)21-7-10-27(25,26)11-8-21/h3-6,9,13H,1-2,7-8,10-12H2 |
| InChIKey | WGLHYAYZHJKKAT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|