C20H21FN4O5 — CID 146243065
4-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)-3-oxopyrazin-2-yl]piperazine-1-carboxylic acid (PubChem CID 146243065) has the molecular formula C20H21FN4O5 and a molecular weight of 416.41 g/mol. Its IUPAC name is 4-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)-3-oxopyrazin-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)-3-oxopyrazin-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 146243065 |
| Molecular Formula | C20H21FN4O5 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[6-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)-3-oxopyrazin-2-yl]piperazine-1-carboxylic acid |
| SMILES | CCOC(=O)/C=C/c1cn(-c2ccc(F)cc2)c(=O)c(N2CCN(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C20H21FN4O5/c1-2-30-17(26)8-5-15-13-25(16-6-3-14(21)4-7-16)19(27)18(22-15)23-9-11-24(12-10-23)20(28)29/h3-8,13H,2,9-12H2,1H3,(H,28,29)/b8-5+ |
| InChIKey | VJMZXQKIXZMXQP-VMPITWQZSA-N |
| XLogP | 1.75 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|