C27H35N3O5 — CID 146244506
N-[(2S)-1-[[1-(cyclohexen-1-yl)-4-(cyclopropylamino)-3,4-dioxobutan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-3-methoxybenzamide (PubChem CID 146244506) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is N-[(2S)-1-[[1-(cyclohexen-1-yl)-4-(cyclopropylamino)-3,4-dioxobutan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-3-methoxybenzamide.
| Compound Name | N-[(2S)-1-[[1-(cyclohexen-1-yl)-4-(cyclopropylamino)-3,4-dioxobutan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 146244506 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | N-[(2S)-1-[[1-(cyclohexen-1-yl)-4-(cyclopropylamino)-3,4-dioxobutan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N[C@@H](CC2CC2)C(=O)NC(CC2=CCCCC2)C(=O)C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C27H35N3O5/c1-35-21-9-5-8-19(16-21)25(32)30-23(15-18-10-11-18)26(33)29-22(14-17-6-3-2-4-7-17)24(31)27(34)28-20-12-13-20/h5-6,8-9,16,18,20,22-23H,2-4,7,10-15H2,1H3,(H,28,34)(H,29,33)(H,30,32)/t22?,23-/m0/s1 |
| InChIKey | NPOQDYOZAFUQQD-WCSIJFPASA-N |
| XLogP | 2.82 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|