C16H14O5S — CID 146244714
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonyl-8-hydroxychromen-2-one (PubChem CID 146244714) has the molecular formula C16H14O5S and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonyl-8-hydroxychromen-2-one.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonyl-8-hydroxychromen-2-one |
|---|---|
| PubChem CID | 146244714 |
| Molecular Formula | C16H14O5S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonyl-8-hydroxychromen-2-one |
| SMILES | C=C/C=C\C(=C/C)S(=O)(=O)c1cc2cccc(O)c2oc1=O |
| InChI | InChI=1S/C16H14O5S/c1-3-5-8-12(4-2)22(19,20)14-10-11-7-6-9-13(17)15(11)21-16(14)18/h3-10,17H,1H2,2H3/b8-5-,12-4+ |
| InChIKey | PZSXGXQPZRRURV-QJQXSPRCSA-N |
| XLogP | 2.92 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|