C11H11NO5S — CID 164628509
8-ethoxy-2-oxochromene-3-sulfonamide (PubChem CID 164628509) has the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. Its IUPAC name is 8-ethoxy-2-oxochromene-3-sulfonamide.
| Compound Name | 8-ethoxy-2-oxochromene-3-sulfonamide |
|---|---|
| PubChem CID | 164628509 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 8-ethoxy-2-oxochromene-3-sulfonamide |
| SMILES | CCOc1cccc2cc(S(N)(=O)=O)c(=O)oc12 |
| InChI | InChI=1S/C11H11NO5S/c1-2-16-8-5-3-4-7-6-9(18(12,14)15)11(13)17-10(7)8/h3-6H,2H2,1H3,(H2,12,14,15) |
| InChIKey | LXRSALAUTHMGJG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|