C17H12Cl2O5S — CID 20864483
3-(3,4-dichlorophenyl)sulfonyl-8-ethoxychromen-2-one (PubChem CID 20864483) has the molecular formula C17H12Cl2O5S and a molecular weight of 399.25 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)sulfonyl-8-ethoxychromen-2-one.
| Compound Name | 3-(3,4-dichlorophenyl)sulfonyl-8-ethoxychromen-2-one |
|---|---|
| PubChem CID | 20864483 |
| Molecular Formula | C17H12Cl2O5S |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 3-(3,4-dichlorophenyl)sulfonyl-8-ethoxychromen-2-one |
| SMILES | CCOc1cccc2cc(S(=O)(=O)c3ccc(Cl)c(Cl)c3)c(=O)oc12 |
| InChI | InChI=1S/C17H12Cl2O5S/c1-2-23-14-5-3-4-10-8-15(17(20)24-16(10)14)25(21,22)11-6-7-12(18)13(19)9-11/h3-9H,2H2,1H3 |
| InChIKey | XACGDMYFGQATSS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|