C15H18N2O4 — CID 146250811
methyl 2-[(2R,5R)-4-benzyl-5-methyl-3,6-dioxopiperazin-2-yl]acetate (PubChem CID 146250811) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 2-[(2R,5R)-4-benzyl-5-methyl-3,6-dioxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,5R)-4-benzyl-5-methyl-3,6-dioxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 146250811 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 2-[(2R,5R)-4-benzyl-5-methyl-3,6-dioxopiperazin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1NC(=O)[C@@H](C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-10-14(19)16-12(8-13(18)21-2)15(20)17(10)9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,16,19)/t10-,12-/m1/s1 |
| InChIKey | FZHSPPFSXLSXKK-ZYHUDNBSSA-N |
| XLogP | 0.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |