C26H30N6O4 — CID 146252114
tert-butyl 4-[3-oxo-6-(3-oxopropyl)-4-(4-pyridazin-3-ylphenyl)pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 146252114) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is tert-butyl 4-[3-oxo-6-(3-oxopropyl)-4-(4-pyridazin-3-ylphenyl)pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-oxo-6-(3-oxopropyl)-4-(4-pyridazin-3-ylphenyl)pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 146252114 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | tert-butyl 4-[3-oxo-6-(3-oxopropyl)-4-(4-pyridazin-3-ylphenyl)pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nc(CCC=O)cn(-c3ccc(-c4cccnn4)cc3)c2=O)CC1 |
| InChI | InChI=1S/C26H30N6O4/c1-26(2,3)36-25(35)31-15-13-30(14-16-31)23-24(34)32(18-20(28-23)6-5-17-33)21-10-8-19(9-11-21)22-7-4-12-27-29-22/h4,7-12,17-18H,5-6,13-16H2,1-3H3 |
| InChIKey | PMZVJUOCQAGKBU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|